C20H21Cl2N3O3 — CID 71881346
2,6-dichloro-N-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 71881346) has the molecular formula C20H21Cl2N3O3 and a molecular weight of 422.31 g/mol. Its IUPAC name is 2,6-dichloro-N-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71881346 |
| Molecular Formula | C20H21Cl2N3O3 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2,6-dichloro-N-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CC1CN(C(=O)c2ccc(CNC(=O)c3ccc(Cl)nc3Cl)cc2)CC(C)O1 |
| InChI | InChI=1S/C20H21Cl2N3O3/c1-12-10-25(11-13(2)28-12)20(27)15-5-3-14(4-6-15)9-23-19(26)16-7-8-17(21)24-18(16)22/h3-8,12-13H,9-11H2,1-2H3,(H,23,26) |
| InChIKey | PICLKEFUOVBFPH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|