C18H28ClN3O3 — CID 120645221
N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]-4-(methoxymethyl)piperidine-4-carboxamide (PubChem CID 120645221) has the molecular formula C18H28ClN3O3 and a molecular weight of 369.89 g/mol. Its IUPAC name is N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]-4-(methoxymethyl)piperidine-4-carboxamide.
| Compound Name | N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]-4-(methoxymethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120645221 |
| Molecular Formula | C18H28ClN3O3 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[3-chloro-4-[2-(dimethylamino)ethoxy]phenyl]-4-(methoxymethyl)piperidine-4-carboxamide |
| SMILES | COCC1(C(=O)Nc2ccc(OCCN(C)C)c(Cl)c2)CCNCC1 |
| InChI | InChI=1S/C18H28ClN3O3/c1-22(2)10-11-25-16-5-4-14(12-15(16)19)21-17(23)18(13-24-3)6-8-20-9-7-18/h4-5,12,20H,6-11,13H2,1-3H3,(H,21,23) |
| InChIKey | FJSKHGFNRPEWBW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |