C22H30Cl2N4O2 — CID 120645944
5-amino-2-methyl-N-[4-oxo-4-(3-pyrrolidin-1-ylanilino)butan-2-yl]benzamide;dihydrochloride (PubChem CID 120645944) has the molecular formula C22H30Cl2N4O2 and a molecular weight of 453.41 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[4-oxo-4-(3-pyrrolidin-1-ylanilino)butan-2-yl]benzamide;dihydrochloride.
| Compound Name | 5-amino-2-methyl-N-[4-oxo-4-(3-pyrrolidin-1-ylanilino)butan-2-yl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 120645944 |
| Molecular Formula | C22H30Cl2N4O2 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 5-amino-2-methyl-N-[4-oxo-4-(3-pyrrolidin-1-ylanilino)butan-2-yl]benzamide;dihydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)NC(C)CC(=O)Nc1cccc(N2CCCC2)c1.Cl.Cl |
| InChI | InChI=1S/C22H28N4O2.2ClH/c1-15-8-9-17(23)13-20(15)22(28)24-16(2)12-21(27)25-18-6-5-7-19(14-18)26-10-3-4-11-26;;/h5-9,13-14,16H,3-4,10-12,23H2,1-2H3,(H,24,28)(H,25,27);2*1H |
| InChIKey | FUHPNJCUJGVNPK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|