C17H29N5O3S — CID 120646246
2-[4-[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-N-(3-methoxypropyl)propanamide (PubChem CID 120646246) has the molecular formula C17H29N5O3S and a molecular weight of 383.52 g/mol. Its IUPAC name is 2-[4-[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-[4-[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 120646246 |
| Molecular Formula | C17H29N5O3S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-[4-[2-(2-aminoethyl)-1,3-thiazole-4-carbonyl]piperazin-1-yl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)N1CCN(C(=O)c2csc(CCN)n2)CC1 |
| InChI | InChI=1S/C17H29N5O3S/c1-13(16(23)19-6-3-11-25-2)21-7-9-22(10-8-21)17(24)14-12-26-15(20-14)4-5-18/h12-13H,3-11,18H2,1-2H3,(H,19,23) |
| InChIKey | ZKBIJGHRXFJTDT-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|