C16H32N4O4 — CID 120596528
2-[4-(4-amino-3-methoxybutanoyl)piperazin-1-yl]-N-(3-methoxypropyl)propanamide (PubChem CID 120596528) has the molecular formula C16H32N4O4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[4-(4-amino-3-methoxybutanoyl)piperazin-1-yl]-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-[4-(4-amino-3-methoxybutanoyl)piperazin-1-yl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 120596528 |
| Molecular Formula | C16H32N4O4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 2-[4-(4-amino-3-methoxybutanoyl)piperazin-1-yl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)N1CCN(C(=O)CC(CN)OC)CC1 |
| InChI | InChI=1S/C16H32N4O4/c1-13(16(22)18-5-4-10-23-2)19-6-8-20(9-7-19)15(21)11-14(12-17)24-3/h13-14H,4-12,17H2,1-3H3,(H,18,22) |
| InChIKey | GUQJTGRRXJDJKV-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|