C18H36Cl2N4O4 — CID 119877454
2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-N-(3-methoxypropyl)propanamide;dihydrochloride (PubChem CID 119877454) has the molecular formula C18H36Cl2N4O4 and a molecular weight of 443.42 g/mol. Its IUPAC name is 2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-N-(3-methoxypropyl)propanamide;dihydrochloride.
| Compound Name | 2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-N-(3-methoxypropyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119877454 |
| Molecular Formula | C18H36Cl2N4O4 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-N-(3-methoxypropyl)propanamide;dihydrochloride |
| SMILES | COCCCNC(=O)C(C)N1CCN(C(=O)C2(OC)CCNCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C18H34N4O4.2ClH/c1-15(16(23)20-7-4-14-25-2)21-10-12-22(13-11-21)17(24)18(26-3)5-8-19-9-6-18;;/h15,19H,4-14H2,1-3H3,(H,20,23);2*1H |
| InChIKey | BKLAFUMRZAFZQF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|