C17H35N3O3 — CID 95311991
(2R)-2-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-N-(3-methoxypropyl)propanamide (PubChem CID 95311991) has the molecular formula C17H35N3O3 and a molecular weight of 329.49 g/mol. Its IUPAC name is (2R)-2-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-N-(3-methoxypropyl)propanamide.
| Compound Name | (2R)-2-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 95311991 |
| Molecular Formula | C17H35N3O3 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | (2R)-2-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)[C@@H](C)N1CCN(C[C@H](O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H35N3O3/c1-14(16(22)18-7-6-12-23-5)20-10-8-19(9-11-20)13-15(21)17(2,3)4/h14-15,21H,6-13H2,1-5H3,(H,18,22)/t14-,15+/m1/s1 |
| InChIKey | KUIHERCTNBPISX-CABCVRRESA-N |
| XLogP | 0.55 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|