C16H31N3O2 — CID 95309166
(2R)-2-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-N-prop-2-enylpropanamide (PubChem CID 95309166) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is (2R)-2-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-N-prop-2-enylpropanamide.
| Compound Name | (2R)-2-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 95309166 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | (2R)-2-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@@H](C)N1CCN(C[C@H](O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H31N3O2/c1-6-7-17-15(21)13(2)19-10-8-18(9-11-19)12-14(20)16(3,4)5/h6,13-14,20H,1,7-12H2,2-5H3,(H,17,21)/t13-,14+/m1/s1 |
| InChIKey | VGIRSGIRECKBAV-KGLIPLIRSA-N |
| XLogP | 0.70 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|