C14H26N4O3S — CID 42896207
N-prop-2-enyl-2-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)propanamide (PubChem CID 42896207) has the molecular formula C14H26N4O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is N-prop-2-enyl-2-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)propanamide.
| Compound Name | N-prop-2-enyl-2-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 42896207 |
| Molecular Formula | C14H26N4O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-prop-2-enyl-2-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)propanamide |
| SMILES | C=CCNC(=O)C(C)N1CCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C14H26N4O3S/c1-3-6-15-14(19)13(2)16-9-11-18(12-10-16)22(20,21)17-7-4-5-8-17/h3,13H,1,4-12H2,2H3,(H,15,19) |
| InChIKey | UBPSTBKEVBZTDF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|