C18H31N3O5 — CID 171668900
oxalic acid;2-(4-piperidin-1-ylpiperidin-1-yl)-N-prop-2-enylpropanamide (PubChem CID 171668900) has the molecular formula C18H31N3O5 and a molecular weight of 369.46 g/mol. Its IUPAC name is oxalic acid;2-(4-piperidin-1-ylpiperidin-1-yl)-N-prop-2-enylpropanamide.
| Compound Name | oxalic acid;2-(4-piperidin-1-ylpiperidin-1-yl)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 171668900 |
| Molecular Formula | C18H31N3O5 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | oxalic acid;2-(4-piperidin-1-ylpiperidin-1-yl)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)N1CCC(N2CCCCC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H29N3O.C2H2O4/c1-3-9-17-16(20)14(2)18-12-7-15(8-13-18)19-10-5-4-6-11-19;3-1(4)2(5)6/h3,14-15H,1,4-13H2,2H3,(H,17,20);(H,3,4)(H,5,6) |
| InChIKey | NHRPOGFEOZDEAI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|