C21H23N3O3S — CID 120649648
N-(3-aminopropyl)-N-benzyl-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide (PubChem CID 120649648) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide.
| Compound Name | N-(3-aminopropyl)-N-benzyl-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 120649648 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
| SMILES | NCCCN(Cc1ccccc1)C(=O)c1cccc(CN2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C21H23N3O3S/c22-10-5-11-23(13-16-6-2-1-3-7-16)20(26)18-9-4-8-17(12-18)14-24-19(25)15-28-21(24)27/h1-4,6-9,12H,5,10-11,13-15,22H2 |
| InChIKey | RKXMCEJCWCYYEE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|