C18H26N4O3 — CID 120649665
N-(3-aminopropyl)-N-benzyl-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide (PubChem CID 120649665) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide.
| Compound Name | N-(3-aminopropyl)-N-benzyl-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 120649665 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide |
| SMILES | CCN1CCN(CC(=O)N(CCCN)Cc2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C18H26N4O3/c1-2-20-11-12-22(18(25)17(20)24)14-16(23)21(10-6-9-19)13-15-7-4-3-5-8-15/h3-5,7-8H,2,6,9-14,19H2,1H3 |
| InChIKey | SQUQIICDDNZIIL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|