C16H27ClN4O2 — CID 120650380
N-[(2R)-2-(ethylamino)propyl]-2-methyl-2-(phenylcarbamoylamino)propanamide;hydrochloride (PubChem CID 120650380) has the molecular formula C16H27ClN4O2 and a molecular weight of 342.87 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2-methyl-2-(phenylcarbamoylamino)propanamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2-methyl-2-(phenylcarbamoylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120650380 |
| Molecular Formula | C16H27ClN4O2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2-methyl-2-(phenylcarbamoylamino)propanamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)C(C)(C)NC(=O)Nc1ccccc1.Cl |
| InChI | InChI=1S/C16H26N4O2.ClH/c1-5-17-12(2)11-18-14(21)16(3,4)20-15(22)19-13-9-7-6-8-10-13;/h6-10,12,17H,5,11H2,1-4H3,(H,18,21)(H2,19,20,22);1H/t12-;/m1./s1 |
| InChIKey | MLQGKEHWPKBYTG-UTONKHPSSA-N |
| XLogP | 2.12 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |