C11H24N2O — CID 120653493
N-[(2R)-2-(ethylamino)propyl]-2,2-dimethylbutanamide (PubChem CID 120653493) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2,2-dimethylbutanamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 120653493 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2,2-dimethylbutanamide |
| SMILES | CCN[C@H](C)CNC(=O)C(C)(C)CC |
| InChI | InChI=1S/C11H24N2O/c1-6-11(4,5)10(14)13-8-9(3)12-7-2/h9,12H,6-8H2,1-5H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | FUUAEYANQIFPJG-SECBINFHSA-N |
| XLogP | 1.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |