C11H25ClN2O — CID 120650462
N-[(2R)-2-(ethylamino)propyl]-4-methylpentanamide;hydrochloride (PubChem CID 120650462) has the molecular formula C11H25ClN2O and a molecular weight of 236.79 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-4-methylpentanamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 120650462 |
| Molecular Formula | C11H25ClN2O |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-4-methylpentanamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)CCC(C)C.Cl |
| InChI | InChI=1S/C11H24N2O.ClH/c1-5-12-10(4)8-13-11(14)7-6-9(2)3;/h9-10,12H,5-8H2,1-4H3,(H,13,14);1H/t10-;/m1./s1 |
| InChIKey | FIEOPQJTIYVXTO-HNCPQSOCSA-N |
| XLogP | 1.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |