C11H27Cl2N3O — CID 120651076
N-[(2R)-2-(ethylamino)propyl]-2-[methyl(propan-2-yl)amino]acetamide;dihydrochloride (PubChem CID 120651076) has the molecular formula C11H27Cl2N3O and a molecular weight of 288.26 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2-[methyl(propan-2-yl)amino]acetamide;dihydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2-[methyl(propan-2-yl)amino]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120651076 |
| Molecular Formula | C11H27Cl2N3O |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2-[methyl(propan-2-yl)amino]acetamide;dihydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)CN(C)C(C)C.Cl.Cl |
| InChI | InChI=1S/C11H25N3O.2ClH/c1-6-12-10(4)7-13-11(15)8-14(5)9(2)3;;/h9-10,12H,6-8H2,1-5H3,(H,13,15);2*1H/t10-;;/m1../s1 |
| InChIKey | RIRGPVLKBZKKNE-YQFADDPSSA-N |
| XLogP | 1.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |