C15H31ClN2O — CID 120650988
3-cyclohexyl-N-[(2R)-2-(ethylamino)propyl]butanamide;hydrochloride (PubChem CID 120650988) has the molecular formula C15H31ClN2O and a molecular weight of 290.88 g/mol. Its IUPAC name is 3-cyclohexyl-N-[(2R)-2-(ethylamino)propyl]butanamide;hydrochloride.
| Compound Name | 3-cyclohexyl-N-[(2R)-2-(ethylamino)propyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120650988 |
| Molecular Formula | C15H31ClN2O |
| Molecular Weight | 290.88 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 3-cyclohexyl-N-[(2R)-2-(ethylamino)propyl]butanamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)CC(C)C1CCCCC1.Cl |
| InChI | InChI=1S/C15H30N2O.ClH/c1-4-16-13(3)11-17-15(18)10-12(2)14-8-6-5-7-9-14;/h12-14,16H,4-11H2,1-3H3,(H,17,18);1H/t12?,13-;/m1./s1 |
| InChIKey | BXZLAHYHPSOWKP-MGWDBEAMSA-N |
| XLogP | 3.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.88 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |