C16H24ClN3O3S2 — CID 120655530
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]methanone;hydrochloride (PubChem CID 120655530) has the molecular formula C16H24ClN3O3S2 and a molecular weight of 405.97 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]methanone;hydrochloride.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120655530 |
| Molecular Formula | C16H24ClN3O3S2 |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]methanone;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)N2C[C@H]3CNC[C@H]3C2)s1.Cl |
| InChI | InChI=1S/C16H23N3O3S2.ClH/c1-11-4-5-15(23-11)24(21,22)19-6-2-3-14(19)16(20)18-9-12-7-17-8-13(12)10-18;/h4-5,12-14,17H,2-3,6-10H2,1H3;1H/t12-,13+,14?; |
| InChIKey | HIMOUMUEQKLNAV-LIWIJTDLSA-N |
| XLogP | 1.31 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |