C21H25N3O2S — CID 120655851
N-[3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]thiophen-2-yl]-4-propan-2-ylbenzamide (PubChem CID 120655851) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is N-[3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]thiophen-2-yl]-4-propan-2-ylbenzamide.
| Compound Name | N-[3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]thiophen-2-yl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 120655851 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-[3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]thiophen-2-yl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)Nc2sccc2C(=O)N2C[C@H]3CNC[C@H]3C2)cc1 |
| InChI | InChI=1S/C21H25N3O2S/c1-13(2)14-3-5-15(6-4-14)19(25)23-20-18(7-8-27-20)21(26)24-11-16-9-22-10-17(16)12-24/h3-8,13,16-17,22H,9-12H2,1-2H3,(H,23,25)/t16-,17+ |
| InChIKey | QQTBGQXXMLCYAN-CALCHBBNSA-N |
| XLogP | 3.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |