C17H18FN3OS — CID 120656620
1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 120656620) has the molecular formula C17H18FN3OS and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 120656620 |
| Molecular Formula | C17H18FN3OS |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | O=C(Cc1csc(-c2cccc(F)c2)n1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C17H18FN3OS/c18-14-3-1-2-11(4-14)17-20-15(10-23-17)5-16(22)21-8-12-6-19-7-13(12)9-21/h1-4,10,12-13,19H,5-9H2/t12-,13+ |
| InChIKey | JCPVHNSCHIZKSY-BETUJISGSA-N |
| XLogP | 2.17 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |