C13H23ClN2O — CID 120658201
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-propylcyclopropyl)methanone;hydrochloride (PubChem CID 120658201) has the molecular formula C13H23ClN2O and a molecular weight of 258.79 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-propylcyclopropyl)methanone;hydrochloride.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-propylcyclopropyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120658201 |
| Molecular Formula | C13H23ClN2O |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-propylcyclopropyl)methanone;hydrochloride |
| SMILES | CCCC1(C(=O)N2C[C@H]3CNC[C@H]3C2)CC1.Cl |
| InChI | InChI=1S/C13H22N2O.ClH/c1-2-3-13(4-5-13)12(16)15-8-10-6-14-7-11(10)9-15;/h10-11,14H,2-9H2,1H3;1H/t10-,11+; |
| InChIKey | SYVNBCSTTRBLNB-NJJJQDLFSA-N |
| XLogP | 1.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |