C15H27ClN4O2 — CID 120659189
1-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]cyclopentyl]-3-ethylurea;hydrochloride (PubChem CID 120659189) has the molecular formula C15H27ClN4O2 and a molecular weight of 330.86 g/mol. Its IUPAC name is 1-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]cyclopentyl]-3-ethylurea;hydrochloride.
| Compound Name | 1-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]cyclopentyl]-3-ethylurea;hydrochloride |
|---|---|
| PubChem CID | 120659189 |
| Molecular Formula | C15H27ClN4O2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]cyclopentyl]-3-ethylurea;hydrochloride |
| SMILES | CCNC(=O)NC1(C(=O)N2C[C@H]3CNC[C@H]3C2)CCCC1.Cl |
| InChI | InChI=1S/C15H26N4O2.ClH/c1-2-17-14(21)18-15(5-3-4-6-15)13(20)19-9-11-7-16-8-12(11)10-19;/h11-12,16H,2-10H2,1H3,(H2,17,18,21);1H/t11-,12+; |
| InChIKey | JLWYMBBMFRUDEV-IWKKHLOMSA-N |
| XLogP | 0.72 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |