C10H19N3O — CID 126591279
(3aS,6aR)-N-ethyl-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 126591279) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is (3aS,6aR)-N-ethyl-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aR)-N-ethyl-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 126591279 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | (3aS,6aR)-N-ethyl-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CCNC(=O)N1C[C@H]2CN(C)C[C@H]2C1 |
| InChI | InChI=1S/C10H19N3O/c1-3-11-10(14)13-6-8-4-12(2)5-9(8)7-13/h8-9H,3-7H2,1-2H3,(H,11,14)/t8-,9+ |
| InChIKey | RAQMUBDVWGIELX-DTORHVGOSA-N |
| XLogP | 0.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |