C10H20N2O2 — CID 164555528
ethane;N-ethyl-6-oxa-3-azabicyclo[3.1.1]heptane-3-carboxamide (PubChem CID 164555528) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is ethane;N-ethyl-6-oxa-3-azabicyclo[3.1.1]heptane-3-carboxamide.
| Compound Name | ethane;N-ethyl-6-oxa-3-azabicyclo[3.1.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 164555528 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | ethane;N-ethyl-6-oxa-3-azabicyclo[3.1.1]heptane-3-carboxamide |
| SMILES | CC.CCNC(=O)N1CC2CC(C1)O2 |
| InChI | InChI=1S/C8H14N2O2.C2H6/c1-2-9-8(11)10-4-6-3-7(5-10)12-6;1-2/h6-7H,2-5H2,1H3,(H,9,11);1-2H3 |
| InChIKey | RXCNXBASSDKFOY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |