C18H29N3O2 — CID 128646285
1-[1-(2,3-dicyclopropylazetidine-1-carbonyl)cyclopentyl]-3-ethylurea (PubChem CID 128646285) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-[1-(2,3-dicyclopropylazetidine-1-carbonyl)cyclopentyl]-3-ethylurea.
| Compound Name | 1-[1-(2,3-dicyclopropylazetidine-1-carbonyl)cyclopentyl]-3-ethylurea |
|---|---|
| PubChem CID | 128646285 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 1-[1-(2,3-dicyclopropylazetidine-1-carbonyl)cyclopentyl]-3-ethylurea |
| SMILES | CCNC(=O)NC1(C(=O)N2CC(C3CC3)C2C2CC2)CCCC1 |
| InChI | InChI=1S/C18H29N3O2/c1-2-19-17(23)20-18(9-3-4-10-18)16(22)21-11-14(12-5-6-12)15(21)13-7-8-13/h12-15H,2-11H2,1H3,(H2,19,20,23) |
| InChIKey | PJUKIMGRHKMSJD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |