C14H27ClN4O2 — CID 119373610
1-[1-(4-aminopiperidine-1-carbonyl)cyclopentyl]-3-ethylurea;hydrochloride (PubChem CID 119373610) has the molecular formula C14H27ClN4O2 and a molecular weight of 318.85 g/mol. Its IUPAC name is 1-[1-(4-aminopiperidine-1-carbonyl)cyclopentyl]-3-ethylurea;hydrochloride.
| Compound Name | 1-[1-(4-aminopiperidine-1-carbonyl)cyclopentyl]-3-ethylurea;hydrochloride |
|---|---|
| PubChem CID | 119373610 |
| Molecular Formula | C14H27ClN4O2 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-[1-(4-aminopiperidine-1-carbonyl)cyclopentyl]-3-ethylurea;hydrochloride |
| SMILES | CCNC(=O)NC1(C(=O)N2CCC(N)CC2)CCCC1.Cl |
| InChI | InChI=1S/C14H26N4O2.ClH/c1-2-16-13(20)17-14(7-3-4-8-14)12(19)18-9-5-11(15)6-10-18;/h11H,2-10,15H2,1H3,(H2,16,17,20);1H |
| InChIKey | MFKNPAFROFZFSI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |