C22H30ClN3O4 — CID 650262
ethyl 1-[1-[(2-chlorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate (PubChem CID 650262) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is ethyl 1-[1-[(2-chlorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[1-[(2-chlorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 650262 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | ethyl 1-[1-[(2-chlorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2(NC(=O)Nc3ccccc3Cl)CCCCC2)CC1 |
| InChI | InChI=1S/C22H30ClN3O4/c1-2-30-19(27)16-10-14-26(15-11-16)20(28)22(12-6-3-7-13-22)25-21(29)24-18-9-5-4-8-17(18)23/h4-5,8-9,16H,2-3,6-7,10-15H2,1H3,(H2,24,25,29) |
| InChIKey | NMPHEYNOLHJYDQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |