C11H20IN3OS — CID 120661743
2-methyl-N'-(2-prop-2-ynylsulfanylethyl)morpholine-4-carboximidamide;hydroiodide (PubChem CID 120661743) has the molecular formula C11H20IN3OS and a molecular weight of 369.27 g/mol. Its IUPAC name is 2-methyl-N'-(2-prop-2-ynylsulfanylethyl)morpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-methyl-N'-(2-prop-2-ynylsulfanylethyl)morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120661743 |
| Molecular Formula | C11H20IN3OS |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2-methyl-N'-(2-prop-2-ynylsulfanylethyl)morpholine-4-carboximidamide;hydroiodide |
| SMILES | C#CCSCC/N=C(\N)N1CCOC(C)C1.I |
| InChI | InChI=1S/C11H19N3OS.HI/c1-3-7-16-8-4-13-11(12)14-5-6-15-10(2)9-14;/h1,10H,4-9H2,2H3,(H2,12,13);1H |
| InChIKey | UOBVZLDKMYTXRF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|