C14H23IN6OS — CID 120662681
5-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide;hydroiodide (PubChem CID 120662681) has the molecular formula C14H23IN6OS and a molecular weight of 450.35 g/mol. Its IUPAC name is 5-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide;hydroiodide.
| Compound Name | 5-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 120662681 |
| Molecular Formula | C14H23IN6OS |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 5-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide;hydroiodide |
| SMILES | I.NC(=O)c1cnn2c1CC(C/N=C(\N)N1CCSCC1)CC2 |
| InChI | InChI=1S/C14H22N6OS.HI/c15-13(21)11-9-18-20-2-1-10(7-12(11)20)8-17-14(16)19-3-5-22-6-4-19;/h9-10H,1-8H2,(H2,15,21)(H2,16,17);1H |
| InChIKey | PMHHWANEORTPDK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|