C16H25N3O3S — CID 120666406
N-[4-[(3,3-dimethylpiperidin-2-yl)methylsulfamoyl]phenyl]acetamide (PubChem CID 120666406) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[4-[(3,3-dimethylpiperidin-2-yl)methylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(3,3-dimethylpiperidin-2-yl)methylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 120666406 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[4-[(3,3-dimethylpiperidin-2-yl)methylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCC2NCCCC2(C)C)cc1 |
| InChI | InChI=1S/C16H25N3O3S/c1-12(20)19-13-5-7-14(8-6-13)23(21,22)18-11-15-16(2,3)9-4-10-17-15/h5-8,15,17-18H,4,9-11H2,1-3H3,(H,19,20) |
| InChIKey | LHAUYNAGKZTUPK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |