C14H19F3N2O2S — CID 120714107
N-[(3,3-dimethylpiperidin-2-yl)methyl]-2,3,4-trifluorobenzenesulfonamide (PubChem CID 120714107) has the molecular formula C14H19F3N2O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is N-[(3,3-dimethylpiperidin-2-yl)methyl]-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 120714107 |
| Molecular Formula | C14H19F3N2O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-2,3,4-trifluorobenzenesulfonamide |
| SMILES | CC1(C)CCCNC1CNS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H19F3N2O2S/c1-14(2)6-3-7-18-11(14)8-19-22(20,21)10-5-4-9(15)12(16)13(10)17/h4-5,11,18-19H,3,6-8H2,1-2H3 |
| InChIKey | HYBQJTRMTOUTJA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|