C17H23N3O2S — CID 120666371
N-[(3,3-dimethylpiperidin-2-yl)methyl]quinoline-5-sulfonamide (PubChem CID 120666371) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[(3,3-dimethylpiperidin-2-yl)methyl]quinoline-5-sulfonamide.
| Compound Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 120666371 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]quinoline-5-sulfonamide |
| SMILES | CC1(C)CCCNC1CNS(=O)(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C17H23N3O2S/c1-17(2)9-5-11-19-16(17)12-20-23(21,22)15-8-3-7-14-13(15)6-4-10-18-14/h3-4,6-8,10,16,19-20H,5,9,11-12H2,1-2H3 |
| InChIKey | ZQGMAGPDTPGZPW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |