C18H20ClN3O — CID 120671482
1-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]-2-[(2-methoxyphenyl)methyl]guanidine (PubChem CID 120671482) has the molecular formula C18H20ClN3O and a molecular weight of 329.83 g/mol. Its IUPAC name is 1-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]-2-[(2-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]-2-[(2-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 120671482 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]-2-[(2-methoxyphenyl)methyl]guanidine |
| SMILES | COc1ccccc1C/N=C(\N)N[C@@H]1C[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3O/c1-23-17-5-3-2-4-13(17)11-21-18(20)22-16-10-15(16)12-6-8-14(19)9-7-12/h2-9,15-16H,10-11H2,1H3,(H3,20,21,22)/t15-,16+/m0/s1 |
| InChIKey | ABSSDLVEFFILTL-JKSUJKDBSA-N |
| XLogP | 3.31 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|