C19H23FIN3O — CID 120671597
1-[3-(2-fluorophenyl)cyclobutyl]-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 120671597) has the molecular formula C19H23FIN3O and a molecular weight of 455.32 g/mol. Its IUPAC name is 1-[3-(2-fluorophenyl)cyclobutyl]-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(2-fluorophenyl)cyclobutyl]-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120671597 |
| Molecular Formula | C19H23FIN3O |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 1-[3-(2-fluorophenyl)cyclobutyl]-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccccc1C/N=C(\N)NC1CC(c2ccccc2F)C1.I |
| InChI | InChI=1S/C19H22FN3O.HI/c1-24-18-9-5-2-6-13(18)12-22-19(21)23-15-10-14(11-15)16-7-3-4-8-17(16)20;/h2-9,14-15H,10-12H2,1H3,(H3,21,22,23);1H |
| InChIKey | RDHTVDLGGYXTLE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|