C20H24IN3O — CID 119259715
1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 119259715) has the molecular formula C20H24IN3O and a molecular weight of 449.34 g/mol. Its IUPAC name is 1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119259715 |
| Molecular Formula | C20H24IN3O |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-ylmethyl)-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccccc1C/N=C(\N)NCC1C2Cc3ccccc3C12.I |
| InChI | InChI=1S/C20H23N3O.HI/c1-24-18-9-5-3-7-14(18)11-22-20(21)23-12-17-16-10-13-6-2-4-8-15(13)19(16)17;/h2-9,16-17,19H,10-12H2,1H3,(H3,21,22,23);1H |
| InChIKey | WUQKRLLHUDTYLP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|