C21H27N3O2 — CID 120603016
1-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]-2-[(2-methoxyphenyl)methyl]guanidine (PubChem CID 120603016) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]-2-[(2-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]-2-[(2-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 120603016 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]-2-[(2-methoxyphenyl)methyl]guanidine |
| SMILES | COc1ccccc1C/N=C(\N)NCC1(O)C2C3CC4C5C3CC2C5C41 |
| InChI | InChI=1S/C21H27N3O2/c1-26-15-5-3-2-4-10(15)8-23-20(22)24-9-21(25)18-12-7-13-16-11(12)6-14(18)17(16)19(13)21/h2-5,11-14,16-19,25H,6-9H2,1H3,(H3,22,23,24) |
| InChIKey | ZFNBKHAMGRAGCS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|