C22H31NO4 — CID 120673914
4-[2-(4-methylphenyl)ethyl-(oxolan-2-ylmethyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120673914) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is 4-[2-(4-methylphenyl)ethyl-(oxolan-2-ylmethyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-(4-methylphenyl)ethyl-(oxolan-2-ylmethyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120673914 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 4-[2-(4-methylphenyl)ethyl-(oxolan-2-ylmethyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(CCN(CC2CCCO2)C(=O)C2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C22H31NO4/c1-16-4-6-17(7-5-16)12-13-23(15-20-3-2-14-27-20)21(24)18-8-10-19(11-9-18)22(25)26/h4-7,18-20H,2-3,8-15H2,1H3,(H,25,26) |
| InChIKey | BIOVXPRLRZPKFM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |