C20H27NO4 — CID 129467722
4-[benzyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 129467722) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-[benzyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[benzyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 129467722 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-[benzyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N(Cc2ccccc2)C[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C20H27NO4/c22-19(16-8-10-17(11-9-16)20(23)24)21(14-18-7-4-12-25-18)13-15-5-2-1-3-6-15/h1-3,5-6,16-18H,4,7-14H2,(H,23,24)/t16?,17?,18-/m1/s1 |
| InChIKey | BDQITHNLWLGPBI-DAWZGUTISA-N |
| XLogP | 3.09 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |