C16H26N2O5S — CID 120674300
4-[(1-cyclopropylsulfonylpiperidin-4-yl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120674300) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is 4-[(1-cyclopropylsulfonylpiperidin-4-yl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(1-cyclopropylsulfonylpiperidin-4-yl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120674300 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-[(1-cyclopropylsulfonylpiperidin-4-yl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NC2CCN(S(=O)(=O)C3CC3)CC2)CC1 |
| InChI | InChI=1S/C16H26N2O5S/c19-15(11-1-3-12(4-2-11)16(20)21)17-13-7-9-18(10-8-13)24(22,23)14-5-6-14/h11-14H,1-10H2,(H,17,19)(H,20,21) |
| InChIKey | JAQLFJRUWLKSHK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |