C12H9F2NO — CID 12067767
5-amino-2-(3,5-difluorophenyl)phenol (PubChem CID 12067767) has the molecular formula C12H9F2NO and a molecular weight of 221.21 g/mol. Its IUPAC name is 5-amino-2-(3,5-difluorophenyl)phenol.
| Compound Name | 5-amino-2-(3,5-difluorophenyl)phenol |
|---|---|
| PubChem CID | 12067767 |
| Molecular Formula | C12H9F2NO |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-amino-2-(3,5-difluorophenyl)phenol |
| SMILES | Nc1ccc(-c2cc(F)cc(F)c2)c(O)c1 |
| InChI | InChI=1S/C12H9F2NO/c13-8-3-7(4-9(14)5-8)11-2-1-10(15)6-12(11)16/h1-6,16H,15H2 |
| InChIKey | KDVQOPIQCODJJL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|