C11H13F4NO3 — CID 120682356
(3aS,6aR)-2-(2,2,3,3-tetrafluoropropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120682356) has the molecular formula C11H13F4NO3 and a molecular weight of 283.22 g/mol. Its IUPAC name is (3aS,6aR)-2-(2,2,3,3-tetrafluoropropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-(2,2,3,3-tetrafluoropropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120682356 |
| Molecular Formula | C11H13F4NO3 |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (3aS,6aR)-2-(2,2,3,3-tetrafluoropropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(N1C[C@@H]2CCC[C@@]2(C(=O)O)C1)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H13F4NO3/c12-7(13)11(14,15)8(17)16-4-6-2-1-3-10(6,5-16)9(18)19/h6-7H,1-5H2,(H,18,19)/t6-,10+/m0/s1 |
| InChIKey | ZEDMWRMDWYMZDX-QUBYGPBYSA-N |
| XLogP | 1.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|