C16H21NO3S — CID 120683857
(3aS,6aR)-2-(2-methyl-2-thiophen-2-ylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120683857) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is (3aS,6aR)-2-(2-methyl-2-thiophen-2-ylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-(2-methyl-2-thiophen-2-ylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120683857 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3aS,6aR)-2-(2-methyl-2-thiophen-2-ylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | CC(C)(C(=O)N1C[C@@H]2CCC[C@@]2(C(=O)O)C1)c1cccs1 |
| InChI | InChI=1S/C16H21NO3S/c1-15(2,12-6-4-8-21-12)13(18)17-9-11-5-3-7-16(11,10-17)14(19)20/h4,6,8,11H,3,5,7,9-10H2,1-2H3,(H,19,20)/t11-,16+/m0/s1 |
| InChIKey | SZAUBFCTUXUWOQ-MEDUHNTESA-N |
| XLogP | 2.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |