C21H21NO5 — CID 120683793
(3aS,6aR)-2-[5-(4-acetylphenyl)furan-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120683793) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is (3aS,6aR)-2-[5-(4-acetylphenyl)furan-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[5-(4-acetylphenyl)furan-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120683793 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (3aS,6aR)-2-[5-(4-acetylphenyl)furan-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)N3C[C@@H]4CCC[C@@]4(C(=O)O)C3)o2)cc1 |
| InChI | InChI=1S/C21H21NO5/c1-13(23)14-4-6-15(7-5-14)17-8-9-18(27-17)19(24)22-11-16-3-2-10-21(16,12-22)20(25)26/h4-9,16H,2-3,10-12H2,1H3,(H,25,26)/t16-,21+/m0/s1 |
| InChIKey | CODYKQULDDGLTC-HRAATJIYSA-N |
| XLogP | 3.48 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |