C22H24N2O5 — CID 2474540
1-[4-[5-[4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbonyl]furan-2-yl]phenyl]ethanone (PubChem CID 2474540) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 1-[4-[5-[4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbonyl]furan-2-yl]phenyl]ethanone.
| Compound Name | 1-[4-[5-[4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbonyl]furan-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 2474540 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[4-[5-[4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbonyl]furan-2-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)N3CCN(C(=O)[C@@H]4CCCO4)CC3)o2)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-15(25)16-4-6-17(7-5-16)18-8-9-20(29-18)22(27)24-12-10-23(11-13-24)21(26)19-3-2-14-28-19/h4-9,19H,2-3,10-14H2,1H3/t19-/m0/s1 |
| InChIKey | LZHBPURSDZACFQ-IBGZPJMESA-N |
| XLogP | 2.61 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |