C20H23N3O5 — CID 120685263
5-[[4-(4-ethoxyphenyl)oxan-4-yl]methylcarbamoyl]pyrazine-2-carboxylic acid (PubChem CID 120685263) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 5-[[4-(4-ethoxyphenyl)oxan-4-yl]methylcarbamoyl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[[4-(4-ethoxyphenyl)oxan-4-yl]methylcarbamoyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 120685263 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 5-[[4-(4-ethoxyphenyl)oxan-4-yl]methylcarbamoyl]pyrazine-2-carboxylic acid |
| SMILES | CCOc1ccc(C2(CNC(=O)c3cnc(C(=O)O)cn3)CCOCC2)cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-2-28-15-5-3-14(4-6-15)20(7-9-27-10-8-20)13-23-18(24)16-11-22-17(12-21-16)19(25)26/h3-6,11-12H,2,7-10,13H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | IEFCBZDQADQTBA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |