C16H20FNO5 — CID 120686277
2-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]-2-methylbutanoic acid (PubChem CID 120686277) has the molecular formula C16H20FNO5 and a molecular weight of 325.34 g/mol. Its IUPAC name is 2-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]-2-methylbutanoic acid.
| Compound Name | 2-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 120686277 |
| Molecular Formula | C16H20FNO5 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NC(=O)CCC(=O)c1ccc(OC)c(F)c1)C(=O)O |
| InChI | InChI=1S/C16H20FNO5/c1-4-16(2,15(21)22)18-14(20)8-6-12(19)10-5-7-13(23-3)11(17)9-10/h5,7,9H,4,6,8H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | GHHQOQXNWXMGGS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |