C15H16BrNO4 — CID 120686289
2-[(5-bromo-7-methyl-1-benzofuran-2-carbonyl)-methylamino]-2-methylpropanoic acid (PubChem CID 120686289) has the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 2-[(5-bromo-7-methyl-1-benzofuran-2-carbonyl)-methylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(5-bromo-7-methyl-1-benzofuran-2-carbonyl)-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120686289 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-[(5-bromo-7-methyl-1-benzofuran-2-carbonyl)-methylamino]-2-methylpropanoic acid |
| SMILES | Cc1cc(Br)cc2cc(C(=O)N(C)C(C)(C)C(=O)O)oc12 |
| InChI | InChI=1S/C15H16BrNO4/c1-8-5-10(16)6-9-7-11(21-12(8)9)13(18)17(4)15(2,3)14(19)20/h5-7H,1-4H3,(H,19,20) |
| InChIKey | NKOZLRNWCPAXAX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |