C16H18BrNO5 — CID 120688689
3-[(5-bromo-7-methyl-1-benzofuran-2-carbonyl)amino]-4-methoxy-3-methylbutanoic acid (PubChem CID 120688689) has the molecular formula C16H18BrNO5 and a molecular weight of 384.23 g/mol. Its IUPAC name is 3-[(5-bromo-7-methyl-1-benzofuran-2-carbonyl)amino]-4-methoxy-3-methylbutanoic acid.
| Compound Name | 3-[(5-bromo-7-methyl-1-benzofuran-2-carbonyl)amino]-4-methoxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 120688689 |
| Molecular Formula | C16H18BrNO5 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 3-[(5-bromo-7-methyl-1-benzofuran-2-carbonyl)amino]-4-methoxy-3-methylbutanoic acid |
| SMILES | COCC(C)(CC(=O)O)NC(=O)c1cc2cc(Br)cc(C)c2o1 |
| InChI | InChI=1S/C16H18BrNO5/c1-9-4-11(17)5-10-6-12(23-14(9)10)15(21)18-16(2,8-22-3)7-13(19)20/h4-6H,7-8H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | GKQXNUYBAGQVKS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |