C17H21NO4 — CID 120686745
2-[4-(2,3-dihydro-1H-indene-4-carbonylamino)oxan-4-yl]acetic acid (PubChem CID 120686745) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1H-indene-4-carbonylamino)oxan-4-yl]acetic acid.
| Compound Name | 2-[4-(2,3-dihydro-1H-indene-4-carbonylamino)oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 120686745 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-[4-(2,3-dihydro-1H-indene-4-carbonylamino)oxan-4-yl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2cccc3c2CCC3)CCOCC1 |
| InChI | InChI=1S/C17H21NO4/c19-15(20)11-17(7-9-22-10-8-17)18-16(21)14-6-2-4-12-3-1-5-13(12)14/h2,4,6H,1,3,5,7-11H2,(H,18,21)(H,19,20) |
| InChIKey | SYTPNPFJXXBNTF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |