C14H19N3O3S — CID 120689106
5-[(2-ethylsulfanylcyclohexyl)carbamoyl]pyrazine-2-carboxylic acid (PubChem CID 120689106) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 5-[(2-ethylsulfanylcyclohexyl)carbamoyl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[(2-ethylsulfanylcyclohexyl)carbamoyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 120689106 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-[(2-ethylsulfanylcyclohexyl)carbamoyl]pyrazine-2-carboxylic acid |
| SMILES | CCSC1CCCCC1NC(=O)c1cnc(C(=O)O)cn1 |
| InChI | InChI=1S/C14H19N3O3S/c1-2-21-12-6-4-3-5-9(12)17-13(18)10-7-16-11(8-15-10)14(19)20/h7-9,12H,2-6H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | FFJRLZITVSEUMY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |